C20H17ClN2O3 — CID 70785542
1-(3-chlorophenyl)-4-(7-methyl-1-benzofuran-2-carbonyl)piperazin-2-one (PubChem CID 70785542) has the molecular formula C20H17ClN2O3 and a molecular weight of 368.82 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-(7-methyl-1-benzofuran-2-carbonyl)piperazin-2-one.
| Compound Name | 1-(3-chlorophenyl)-4-(7-methyl-1-benzofuran-2-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 70785542 |
| Molecular Formula | C20H17ClN2O3 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 1-(3-chlorophenyl)-4-(7-methyl-1-benzofuran-2-carbonyl)piperazin-2-one |
| SMILES | Cc1cccc2cc(C(=O)N3CCN(c4cccc(Cl)c4)C(=O)C3)oc12 |
| InChI | InChI=1S/C20H17ClN2O3/c1-13-4-2-5-14-10-17(26-19(13)14)20(25)22-8-9-23(18(24)12-22)16-7-3-6-15(21)11-16/h2-7,10-11H,8-9,12H2,1H3 |
| InChIKey | WIJPOYYKYKWKQF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |