C15H17ClN4O — CID 122672568
8-azido-2-(3-chlorophenyl)-2-azaspiro[4.5]decan-1-one (PubChem CID 122672568) has the molecular formula C15H17ClN4O and a molecular weight of 304.78 g/mol. Its IUPAC name is 8-azido-2-(3-chlorophenyl)-2-azaspiro[4.5]decan-1-one.
| Compound Name | 8-azido-2-(3-chlorophenyl)-2-azaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 122672568 |
| Molecular Formula | C15H17ClN4O |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 8-azido-2-(3-chlorophenyl)-2-azaspiro[4.5]decan-1-one |
| SMILES | [N-]=[N+]=NC1CCC2(CC1)CCN(c1cccc(Cl)c1)C2=O |
| InChI | InChI=1S/C15H17ClN4O/c16-11-2-1-3-13(10-11)20-9-8-15(14(20)21)6-4-12(5-7-15)18-19-17/h1-3,10,12H,4-9H2 |
| InChIKey | MXVDJRYCQQKYNY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 69.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|