C17H20ClNO2 — CID 58237139
(5R,7R)-7-acetyl-2-(3-chlorophenyl)-2-azaspiro[4.5]decan-1-one (PubChem CID 58237139) has the molecular formula C17H20ClNO2 and a molecular weight of 305.81 g/mol. Its IUPAC name is (5R,7R)-7-acetyl-2-(3-chlorophenyl)-2-azaspiro[4.5]decan-1-one.
| Compound Name | (5R,7R)-7-acetyl-2-(3-chlorophenyl)-2-azaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 58237139 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | (5R,7R)-7-acetyl-2-(3-chlorophenyl)-2-azaspiro[4.5]decan-1-one |
| SMILES | CC(=O)[C@@H]1CCC[C@]2(CCN(c3cccc(Cl)c3)C2=O)C1 |
| InChI | InChI=1S/C17H20ClNO2/c1-12(20)13-4-3-7-17(11-13)8-9-19(16(17)21)15-6-2-5-14(18)10-15/h2,5-6,10,13H,3-4,7-9,11H2,1H3/t13-,17+/m1/s1 |
| InChIKey | YVGNPKVBGCGOIB-DYVFJYSZSA-N |
| XLogP | 3.84 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |