C12H10ClN3O2 — CID 7290040
(3R,3aR,6aS)-5-(3-chlorophenyl)-3-methyl-3a,6a-dihydro-3H-pyrrolo[3,4-c]pyrazole-4,6-dione (PubChem CID 7290040) has the molecular formula C12H10ClN3O2 and a molecular weight of 263.68 g/mol. Its IUPAC name is (3R,3aR,6aS)-5-(3-chlorophenyl)-3-methyl-3a,6a-dihydro-3H-pyrrolo[3,4-c]pyrazole-4,6-dione.
| Compound Name | (3R,3aR,6aS)-5-(3-chlorophenyl)-3-methyl-3a,6a-dihydro-3H-pyrrolo[3,4-c]pyrazole-4,6-dione |
|---|---|
| PubChem CID | 7290040 |
| Molecular Formula | C12H10ClN3O2 |
| Molecular Weight | 263.68 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | (3R,3aR,6aS)-5-(3-chlorophenyl)-3-methyl-3a,6a-dihydro-3H-pyrrolo[3,4-c]pyrazole-4,6-dione |
| SMILES | C[C@H]1N=N[C@@H]2C(=O)N(c3cccc(Cl)c3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C12H10ClN3O2/c1-6-9-10(15-14-6)12(18)16(11(9)17)8-4-2-3-7(13)5-8/h2-6,9-10H,1H3/t6-,9-,10+/m1/s1 |
| InChIKey | MUFHFKUMNUGBLY-DRTBCBBWSA-N |
| XLogP | 2.05 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.68 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|