C16H8Cl3NO2 — CID 24952066
1-(3-chlorophenyl)-3-(3,4-dichlorophenyl)pyrrole-2,5-dione (PubChem CID 24952066) has the molecular formula C16H8Cl3NO2 and a molecular weight of 352.60 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(3,4-dichlorophenyl)pyrrole-2,5-dione.
| Compound Name | 1-(3-chlorophenyl)-3-(3,4-dichlorophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 24952066 |
| Molecular Formula | C16H8Cl3NO2 |
| Molecular Weight | 352.60 g/mol |
| Exact Mass | 350.96 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(3,4-dichlorophenyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(c2ccc(Cl)c(Cl)c2)C(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H8Cl3NO2/c17-10-2-1-3-11(7-10)20-15(21)8-12(16(20)22)9-4-5-13(18)14(19)6-9/h1-8H |
| InChIKey | VRZMVAXYJKUJEX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.60 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|