C13H5Cl3N2O2 — CID 3623386
5-chloro-2-(2,6-dichloro-4-pyridinyl)isoindole-1,3-dione (PubChem CID 3623386) has the molecular formula C13H5Cl3N2O2 and a molecular weight of 327.55 g/mol. Its IUPAC name is 5-chloro-2-(2,6-dichloro-4-pyridinyl)isoindole-1,3-dione.
| Compound Name | 5-chloro-2-(2,6-dichloro-4-pyridinyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 3623386 |
| Molecular Formula | C13H5Cl3N2O2 |
| Molecular Weight | 327.55 g/mol |
| Exact Mass | 325.94 |
| IUPAC Name | 5-chloro-2-(2,6-dichloro-4-pyridinyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccc(Cl)cc2C(=O)N1c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C13H5Cl3N2O2/c14-6-1-2-8-9(3-6)13(20)18(12(8)19)7-4-10(15)17-11(16)5-7/h1-5H |
| InChIKey | QUSZAXIMVKKDPF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|