C19H20ClN3O2 — CID 70840125
2-[4-(5-aminopentylamino)phenyl]-5-chloroisoindole-1,3-dione (PubChem CID 70840125) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is 2-[4-(5-aminopentylamino)phenyl]-5-chloroisoindole-1,3-dione.
| Compound Name | 2-[4-(5-aminopentylamino)phenyl]-5-chloroisoindole-1,3-dione |
|---|---|
| PubChem CID | 70840125 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-[4-(5-aminopentylamino)phenyl]-5-chloroisoindole-1,3-dione |
| SMILES | NCCCCCNc1ccc(N2C(=O)c3ccc(Cl)cc3C2=O)cc1 |
| InChI | InChI=1S/C19H20ClN3O2/c20-13-4-9-16-17(12-13)19(25)23(18(16)24)15-7-5-14(6-8-15)22-11-3-1-2-10-21/h4-9,12,22H,1-3,10-11,21H2 |
| InChIKey | XTRRYRLVBQTQCM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|