C21H25ClN2O3S — CID 69328776
4-[[3-(4-chlorophenyl)-1,1-dioxo-1,2-benzothiazol-6-yl]oxy]-N-methyl-N-propan-2-ylbutan-1-amine (PubChem CID 69328776) has the molecular formula C21H25ClN2O3S and a molecular weight of 420.96 g/mol. Its IUPAC name is 4-[[3-(4-chlorophenyl)-1,1-dioxo-1,2-benzothiazol-6-yl]oxy]-N-methyl-N-propan-2-ylbutan-1-amine.
| Compound Name | 4-[[3-(4-chlorophenyl)-1,1-dioxo-1,2-benzothiazol-6-yl]oxy]-N-methyl-N-propan-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 69328776 |
| Molecular Formula | C21H25ClN2O3S |
| Molecular Weight | 420.96 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 4-[[3-(4-chlorophenyl)-1,1-dioxo-1,2-benzothiazol-6-yl]oxy]-N-methyl-N-propan-2-ylbutan-1-amine |
| SMILES | CC(C)N(C)CCCCOc1ccc2c(c1)S(=O)(=O)N=C2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H25ClN2O3S/c1-15(2)24(3)12-4-5-13-27-18-10-11-19-20(14-18)28(25,26)23-21(19)16-6-8-17(22)9-7-16/h6-11,14-15H,4-5,12-13H2,1-3H3 |
| InChIKey | FNARGCQXVTYYPR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.96 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|