C29H26ClN3O8 — CID 135828192
2-[4-[4-[4-(2-acetyloxyethoxy)-2-hydroxyphenyl]-6-(4-chlorophenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]ethyl acetate (PubChem CID 135828192) has the molecular formula C29H26ClN3O8 and a molecular weight of 579.99 g/mol. Its IUPAC name is 2-[4-[4-[4-(2-acetyloxyethoxy)-2-hydroxyphenyl]-6-(4-chlorophenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]ethyl acetate.
| Compound Name | 2-[4-[4-[4-(2-acetyloxyethoxy)-2-hydroxyphenyl]-6-(4-chlorophenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]ethyl acetate |
|---|---|
| PubChem CID | 135828192 |
| Molecular Formula | C29H26ClN3O8 |
| Molecular Weight | 579.99 g/mol |
| Exact Mass | 579.14 |
| IUPAC Name | 2-[4-[4-[4-(2-acetyloxyethoxy)-2-hydroxyphenyl]-6-(4-chlorophenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]ethyl acetate |
| SMILES | CC(=O)OCCOc1ccc(-c2nc(-c3ccc(Cl)cc3)nc(-c3ccc(OCCOC(C)=O)cc3O)n2)c(O)c1 |
| InChI | InChI=1S/C29H26ClN3O8/c1-17(34)38-11-13-40-21-7-9-23(25(36)15-21)28-31-27(19-3-5-20(30)6-4-19)32-29(33-28)24-10-8-22(16-26(24)37)41-14-12-39-18(2)35/h3-10,15-16,36-37H,11-14H2,1-2H3 |
| InChIKey | POHXPVPPMDIIOA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 150.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.99 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|