C14H9FN2O4S — CID 134102064
(1,1-dioxo-1,2-benzothiazol-3-yl) N-(4-fluorophenyl)carbamate (PubChem CID 134102064) has the molecular formula C14H9FN2O4S and a molecular weight of 320.30 g/mol. Its IUPAC name is (1,1-dioxo-1,2-benzothiazol-3-yl) N-(4-fluorophenyl)carbamate.
| Compound Name | (1,1-dioxo-1,2-benzothiazol-3-yl) N-(4-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 134102064 |
| Molecular Formula | C14H9FN2O4S |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | (1,1-dioxo-1,2-benzothiazol-3-yl) N-(4-fluorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(F)cc1)OC1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C14H9FN2O4S/c15-9-5-7-10(8-6-9)16-14(18)21-13-11-3-1-2-4-12(11)22(19,20)17-13/h1-8H,(H,16,18) |
| InChIKey | QMAXEQQQXFOKSK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |