C24H30N2O — CID 146451681
5-[3-(diethylamino)phenoxy]-1,3-diethylnaphthalen-2-amine (PubChem CID 146451681) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is 5-[3-(diethylamino)phenoxy]-1,3-diethylnaphthalen-2-amine.
| Compound Name | 5-[3-(diethylamino)phenoxy]-1,3-diethylnaphthalen-2-amine |
|---|---|
| PubChem CID | 146451681 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 5-[3-(diethylamino)phenoxy]-1,3-diethylnaphthalen-2-amine |
| SMILES | CCc1cc2c(Oc3cccc(N(CC)CC)c3)cccc2c(CC)c1N |
| InChI | InChI=1S/C24H30N2O/c1-5-17-15-22-21(20(6-2)24(17)25)13-10-14-23(22)27-19-12-9-11-18(16-19)26(7-3)8-4/h9-16H,5-8,25H2,1-4H3 |
| InChIKey | RKXHWJOPPHZHJO-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|