About [3-(diethylamino)phenyl] N-ethylcarbamate;iodomethane
[3-(diethylamino)phenyl] N-ethylcarbamate;iodomethane (PubChem CID 23621882) has the molecular formula C14H23IN2O2
and a molecular weight of 378.25 g/mol. Its IUPAC name is [3-(diethylamino)phenyl] N-ethylcarbamate;iodomethane.
Molecular Properties
| Compound Name | [3-(diethylamino)phenyl] N-ethylcarbamate;iodomethane |
| PubChem CID | 23621882 |
| Molecular Formula | C14H23IN2O2 |
| Molecular Weight | 378.25 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | [3-(diethylamino)phenyl] N-ethylcarbamate;iodomethane |
| SMILES | CCNC(=O)Oc1cccc(N(CC)CC)c1.CI |
| InChI | InChI=1S/C13H20N2O2.CH3I/c1-4-14-13(16)17-12-9-7-8-11(10-12)15(5-2)6-3;1-2/h7-10H,4-6H2,1-3H3,(H,14,16);1H3 |
| InChIKey | AGNSMLALOALUPK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.25 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [3-(diethylamino)phenyl] N-ethylcarbamate;iodomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(diethylamino)phenyl] N-ethylcarbamate;iodomethane?
The IUPAC name of [3-(diethylamino)phenyl] N-ethylcarbamate;iodomethane (CID 23621882) is [3-(diethylamino)phenyl] N-ethylcarbamate;iodomethane.
What is the SMILES notation for [3-(diethylamino)phenyl] N-ethylcarbamate;iodomethane?
The canonical SMILES for [3-(diethylamino)phenyl] N-ethylcarbamate;iodomethane is CCNC(=O)Oc1cccc(N(CC)CC)c1.CI.
What is the InChIKey of [3-(diethylamino)phenyl] N-ethylcarbamate;iodomethane?
The InChIKey is AGNSMLALOALUPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2.CH3I/c1-4-14-13(16)17-12-9-7-8-11(10-12)15(5-2)6-3;1-2/h7-10H,4-6H2,1-3H3,(H,14,16);1H3.
What are the key properties of [3-(diethylamino)phenyl] N-ethylcarbamate;iodomethane?
[3-(diethylamino)phenyl] N-ethylcarbamate;iodomethane has a molecular weight of 378.25 g/mol, XLogP of 3.69, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(diethylamino)phenyl] N-ethylcarbamate;iodomethane is sourced from PubChem (CID 23621882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).