C14H17F3N2O3 — CID 23248504
[3-(diethylamino)phenyl] 2,2,2-trifluoro-N-methoxycarbonylethanimidate (PubChem CID 23248504) has the molecular formula C14H17F3N2O3 and a molecular weight of 318.30 g/mol. Its IUPAC name is [3-(diethylamino)phenyl] 2,2,2-trifluoro-N-methoxycarbonylethanimidate.
| Compound Name | [3-(diethylamino)phenyl] 2,2,2-trifluoro-N-methoxycarbonylethanimidate |
|---|---|
| PubChem CID | 23248504 |
| Molecular Formula | C14H17F3N2O3 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | [3-(diethylamino)phenyl] 2,2,2-trifluoro-N-methoxycarbonylethanimidate |
| SMILES | CCN(CC)c1cccc(OC(=NC(=O)OC)C(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F3N2O3/c1-4-19(5-2)10-7-6-8-11(9-10)22-12(14(15,16)17)18-13(20)21-3/h6-9H,4-5H2,1-3H3 |
| InChIKey | NXDWREGJNAFZHF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|