C21H26N2O4S — CID 118535278
[3-(diethylamino)phenyl] 4-(2-sulfanylethylcarbamoyloxymethyl)benzoate (PubChem CID 118535278) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is [3-(diethylamino)phenyl] 4-(2-sulfanylethylcarbamoyloxymethyl)benzoate.
| Compound Name | [3-(diethylamino)phenyl] 4-(2-sulfanylethylcarbamoyloxymethyl)benzoate |
|---|---|
| PubChem CID | 118535278 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | [3-(diethylamino)phenyl] 4-(2-sulfanylethylcarbamoyloxymethyl)benzoate |
| SMILES | CCN(CC)c1cccc(OC(=O)c2ccc(COC(=O)NCCS)cc2)c1 |
| InChI | InChI=1S/C21H26N2O4S/c1-3-23(4-2)18-6-5-7-19(14-18)27-20(24)17-10-8-16(9-11-17)15-26-21(25)22-12-13-28/h5-11,14,28H,3-4,12-13,15H2,1-2H3,(H,22,25) |
| InChIKey | YPEKCZOJPQWFIK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|