C13H20N2O2 — CID 169440124
[3-[(1S)-1-[bis(trideuteriomethyl)amino]ethyl]phenyl] N-ethylcarbamate (PubChem CID 169440124) has the molecular formula C13H20N2O2 and a molecular weight of 242.35 g/mol. Its IUPAC name is [3-[(1S)-1-[bis(trideuteriomethyl)amino]ethyl]phenyl] N-ethylcarbamate.
| Compound Name | [3-[(1S)-1-[bis(trideuteriomethyl)amino]ethyl]phenyl] N-ethylcarbamate |
|---|---|
| PubChem CID | 169440124 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | [3-[(1S)-1-[bis(trideuteriomethyl)amino]ethyl]phenyl] N-ethylcarbamate |
| SMILES | [2H]C([2H])([2H])N([C@@H](C)c1cccc(OC(=O)NCC)c1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C13H20N2O2/c1-5-14-13(16)17-12-8-6-7-11(9-12)10(2)15(3)4/h6-10H,5H2,1-4H3,(H,14,16)/t10-/m0/s1/i3D3,4D3 |
| InChIKey | UBMYZKQTEJHAKE-JBOFIZCNSA-N |
| XLogP | 2.42 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |