C14H23N2O2+ — CID 23160019
[3-[1-(dimethylamino)ethyl]phenyl] N-ethyl-N-methylcarbamate;hydron (PubChem CID 23160019) has the molecular formula C14H23N2O2+ and a molecular weight of 251.35 g/mol. Its IUPAC name is [3-[1-(dimethylamino)ethyl]phenyl] N-ethyl-N-methylcarbamate;hydron.
| Compound Name | [3-[1-(dimethylamino)ethyl]phenyl] N-ethyl-N-methylcarbamate;hydron |
|---|---|
| PubChem CID | 23160019 |
| Molecular Formula | C14H23N2O2+ |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.18 |
| IUPAC Name | [3-[1-(dimethylamino)ethyl]phenyl] N-ethyl-N-methylcarbamate;hydron |
| SMILES | CCN(C)C(=O)Oc1cccc(C(C)N(C)C)c1.[H+] |
| InChI | InChI=1S/C14H22N2O2/c1-6-16(5)14(17)18-13-9-7-8-12(10-13)11(2)15(3)4/h7-11H,6H2,1-5H3/p+1 |
| InChIKey | XSVMFMHYUFZWBK-UHFFFAOYSA-O |
| XLogP | 2.87 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |