C20H21NO6 — CID 146474491
2-[1-[3-[ethyl(methyl)carbamoyl]oxyphenyl]ethoxycarbonyl]benzoic acid (PubChem CID 146474491) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is 2-[1-[3-[ethyl(methyl)carbamoyl]oxyphenyl]ethoxycarbonyl]benzoic acid.
| Compound Name | 2-[1-[3-[ethyl(methyl)carbamoyl]oxyphenyl]ethoxycarbonyl]benzoic acid |
|---|---|
| PubChem CID | 146474491 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2-[1-[3-[ethyl(methyl)carbamoyl]oxyphenyl]ethoxycarbonyl]benzoic acid |
| SMILES | CCN(C)C(=O)Oc1cccc(C(C)OC(=O)c2ccccc2C(=O)O)c1 |
| InChI | InChI=1S/C20H21NO6/c1-4-21(3)20(25)27-15-9-7-8-14(12-15)13(2)26-19(24)17-11-6-5-10-16(17)18(22)23/h5-13H,4H2,1-3H3,(H,22,23) |
| InChIKey | ZCAVAJLLEHWORP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |