C14H22N2O2 — CID 10777494
[3-[(1S)-1-[bis(trideuteriomethyl)amino]ethyl]phenyl] N-ethyl-N-methylcarbamate (PubChem CID 10777494) has the molecular formula C14H22N2O2 and a molecular weight of 256.38 g/mol. Its IUPAC name is [3-[(1S)-1-[bis(trideuteriomethyl)amino]ethyl]phenyl] N-ethyl-N-methylcarbamate.
| Compound Name | [3-[(1S)-1-[bis(trideuteriomethyl)amino]ethyl]phenyl] N-ethyl-N-methylcarbamate |
|---|---|
| PubChem CID | 10777494 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 256.38 g/mol |
| Exact Mass | 256.21 |
| IUPAC Name | [3-[(1S)-1-[bis(trideuteriomethyl)amino]ethyl]phenyl] N-ethyl-N-methylcarbamate |
| SMILES | [2H]C([2H])([2H])N([C@@H](C)c1cccc(OC(=O)N(C)CC)c1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C14H22N2O2/c1-6-16(5)14(17)18-13-9-7-8-12(10-13)11(2)15(3)4/h7-11H,6H2,1-5H3/t11-/m0/s1/i3D3,4D3 |
| InChIKey | XSVMFMHYUFZWBK-HUQNHLMMSA-N |
| XLogP | 2.76 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |