C21H34N2O2 — CID 74428300
[3-[1-(dimethylamino)ethyl]phenyl] N-(1-cyclohexylpropan-2-yl)-N-methylcarbamate (PubChem CID 74428300) has the molecular formula C21H34N2O2 and a molecular weight of 346.52 g/mol. Its IUPAC name is [3-[1-(dimethylamino)ethyl]phenyl] N-(1-cyclohexylpropan-2-yl)-N-methylcarbamate.
| Compound Name | [3-[1-(dimethylamino)ethyl]phenyl] N-(1-cyclohexylpropan-2-yl)-N-methylcarbamate |
|---|---|
| PubChem CID | 74428300 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | [3-[1-(dimethylamino)ethyl]phenyl] N-(1-cyclohexylpropan-2-yl)-N-methylcarbamate |
| SMILES | CC(c1cccc(OC(=O)N(C)C(C)CC2CCCCC2)c1)N(C)C |
| InChI | InChI=1S/C21H34N2O2/c1-16(14-18-10-7-6-8-11-18)23(5)21(24)25-20-13-9-12-19(15-20)17(2)22(3)4/h9,12-13,15-18H,6-8,10-11,14H2,1-5H3 |
| InChIKey | ISRKDVFECZHTSK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |