C22H38N2O2 — CID 143928747
1-cyclohexyl-N,N-dimethylpropan-2-amine;[3-[1-(dimethylamino)ethyl]phenyl] formate (PubChem CID 143928747) has the molecular formula C22H38N2O2 and a molecular weight of 362.56 g/mol. Its IUPAC name is 1-cyclohexyl-N,N-dimethylpropan-2-amine;[3-[1-(dimethylamino)ethyl]phenyl] formate.
| Compound Name | 1-cyclohexyl-N,N-dimethylpropan-2-amine;[3-[1-(dimethylamino)ethyl]phenyl] formate |
|---|---|
| PubChem CID | 143928747 |
| Molecular Formula | C22H38N2O2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.29 |
| IUPAC Name | 1-cyclohexyl-N,N-dimethylpropan-2-amine;[3-[1-(dimethylamino)ethyl]phenyl] formate |
| SMILES | CC(CC1CCCCC1)N(C)C.CC(c1cccc(OC=O)c1)N(C)C |
| InChI | InChI=1S/C11H15NO2.C11H23N/c1-9(12(2)3)10-5-4-6-11(7-10)14-8-13;1-10(12(2)3)9-11-7-5-4-6-8-11/h4-9H,1-3H3;10-11H,4-9H2,1-3H3 |
| InChIKey | VWTRRHGPGKRJDT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|