C23H25N3O2S — CID 143733575
[3-[1-(dimethylamino)ethyl]phenyl] N-[4-(4-aminophenyl)sulfanylphenyl]carbamate (PubChem CID 143733575) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is [3-[1-(dimethylamino)ethyl]phenyl] N-[4-(4-aminophenyl)sulfanylphenyl]carbamate.
| Compound Name | [3-[1-(dimethylamino)ethyl]phenyl] N-[4-(4-aminophenyl)sulfanylphenyl]carbamate |
|---|---|
| PubChem CID | 143733575 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | [3-[1-(dimethylamino)ethyl]phenyl] N-[4-(4-aminophenyl)sulfanylphenyl]carbamate |
| SMILES | CC(c1cccc(OC(=O)Nc2ccc(Sc3ccc(N)cc3)cc2)c1)N(C)C |
| InChI | InChI=1S/C23H25N3O2S/c1-16(26(2)3)17-5-4-6-20(15-17)28-23(27)25-19-9-13-22(14-10-19)29-21-11-7-18(24)8-12-21/h4-16H,24H2,1-3H3,(H,25,27) |
| InChIKey | XACVCWMNAVBYOB-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|