C26H10F8O6 — CID 139971372
4-[3-[4-(4-carboxyphenoxy)-2,3,5,6-tetrafluorophenyl]-2,4,5,6-tetrafluorophenoxy]benzoic acid (PubChem CID 139971372) has the molecular formula C26H10F8O6 and a molecular weight of 570.34 g/mol. Its IUPAC name is 4-[3-[4-(4-carboxyphenoxy)-2,3,5,6-tetrafluorophenyl]-2,4,5,6-tetrafluorophenoxy]benzoic acid.
| Compound Name | 4-[3-[4-(4-carboxyphenoxy)-2,3,5,6-tetrafluorophenyl]-2,4,5,6-tetrafluorophenoxy]benzoic acid |
|---|---|
| PubChem CID | 139971372 |
| Molecular Formula | C26H10F8O6 |
| Molecular Weight | 570.34 g/mol |
| Exact Mass | 570.03 |
| IUPAC Name | 4-[3-[4-(4-carboxyphenoxy)-2,3,5,6-tetrafluorophenyl]-2,4,5,6-tetrafluorophenoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(Oc2c(F)c(F)c(-c3c(F)c(F)c(F)c(Oc4ccc(C(=O)O)cc4)c3F)c(F)c2F)cc1 |
| InChI | InChI=1S/C26H10F8O6/c27-15-14(18(30)23(22(34)19(15)31)39-11-5-1-9(2-6-11)25(35)36)13-16(28)20(32)24(21(33)17(13)29)40-12-7-3-10(4-8-12)26(37)38/h1-8H,(H,35,36)(H,37,38) |
| InChIKey | SMQZDOIUPCVGKI-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.34 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|