C13H6F4O4 — CID 165069523
4-(2,3,5,6-tetrafluoro-4-hydroxyphenoxy)benzoic acid (PubChem CID 165069523) has the molecular formula C13H6F4O4 and a molecular weight of 302.18 g/mol. Its IUPAC name is 4-(2,3,5,6-tetrafluoro-4-hydroxyphenoxy)benzoic acid.
| Compound Name | 4-(2,3,5,6-tetrafluoro-4-hydroxyphenoxy)benzoic acid |
|---|---|
| PubChem CID | 165069523 |
| Molecular Formula | C13H6F4O4 |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 4-(2,3,5,6-tetrafluoro-4-hydroxyphenoxy)benzoic acid |
| SMILES | O=C(O)c1ccc(Oc2c(F)c(F)c(O)c(F)c2F)cc1 |
| InChI | InChI=1S/C13H6F4O4/c14-7-9(16)12(10(17)8(15)11(7)18)21-6-3-1-5(2-4-6)13(19)20/h1-4,18H,(H,19,20) |
| InChIKey | JASUIVMTIBIABN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|