C26H18F4N2O6 — CID 158765392
2-amino-5-[4-(4-amino-3-carboxyphenoxy)-2,3,5,6-tetrafluorophenoxy]benzoic acid;benzene (PubChem CID 158765392) has the molecular formula C26H18F4N2O6 and a molecular weight of 530.43 g/mol. Its IUPAC name is 2-amino-5-[4-(4-amino-3-carboxyphenoxy)-2,3,5,6-tetrafluorophenoxy]benzoic acid;benzene.
| Compound Name | 2-amino-5-[4-(4-amino-3-carboxyphenoxy)-2,3,5,6-tetrafluorophenoxy]benzoic acid;benzene |
|---|---|
| PubChem CID | 158765392 |
| Molecular Formula | C26H18F4N2O6 |
| Molecular Weight | 530.43 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | 2-amino-5-[4-(4-amino-3-carboxyphenoxy)-2,3,5,6-tetrafluorophenoxy]benzoic acid;benzene |
| SMILES | Nc1ccc(Oc2c(F)c(F)c(Oc3ccc(N)c(C(=O)O)c3)c(F)c2F)cc1C(=O)O.c1ccccc1 |
| InChI | InChI=1S/C20H12F4N2O6.C6H6/c21-13-15(23)18(32-8-2-4-12(26)10(6-8)20(29)30)16(24)14(22)17(13)31-7-1-3-11(25)9(5-7)19(27)28;1-2-4-6-5-3-1/h1-6H,25-26H2,(H,27,28)(H,29,30);1-6H |
| InChIKey | IPEQUEXZYDGCFF-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.43 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|