C18H12F4N2O4 — CID 139971174
2-amino-5-[2-(4-amino-3-hydroxyphenoxy)-3,4,5,6-tetrafluorophenoxy]phenol (PubChem CID 139971174) has the molecular formula C18H12F4N2O4 and a molecular weight of 396.30 g/mol. Its IUPAC name is 2-amino-5-[2-(4-amino-3-hydroxyphenoxy)-3,4,5,6-tetrafluorophenoxy]phenol.
| Compound Name | 2-amino-5-[2-(4-amino-3-hydroxyphenoxy)-3,4,5,6-tetrafluorophenoxy]phenol |
|---|---|
| PubChem CID | 139971174 |
| Molecular Formula | C18H12F4N2O4 |
| Molecular Weight | 396.30 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 2-amino-5-[2-(4-amino-3-hydroxyphenoxy)-3,4,5,6-tetrafluorophenoxy]phenol |
| SMILES | Nc1ccc(Oc2c(F)c(F)c(F)c(F)c2Oc2ccc(N)c(O)c2)cc1O |
| InChI | InChI=1S/C18H12F4N2O4/c19-13-14(20)16(22)18(28-8-2-4-10(24)12(26)6-8)17(15(13)21)27-7-1-3-9(23)11(25)5-7/h1-6,25-26H,23-24H2 |
| InChIKey | FHUPJRDHPVAVLF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.30 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|