C25H18F3N3O8 — CID 67567975
4-[[4-(4-amino-3-hydroxyphenoxy)-3,5,6-trifluoro-2-pyridinyl]oxy]benzoic acid;(2-aminophenyl) hydrogen carbonate (PubChem CID 67567975) has the molecular formula C25H18F3N3O8 and a molecular weight of 545.43 g/mol. Its IUPAC name is 4-[[4-(4-amino-3-hydroxyphenoxy)-3,5,6-trifluoro-2-pyridinyl]oxy]benzoic acid;(2-aminophenyl) hydrogen carbonate.
| Compound Name | 4-[[4-(4-amino-3-hydroxyphenoxy)-3,5,6-trifluoro-2-pyridinyl]oxy]benzoic acid;(2-aminophenyl) hydrogen carbonate |
|---|---|
| PubChem CID | 67567975 |
| Molecular Formula | C25H18F3N3O8 |
| Molecular Weight | 545.43 g/mol |
| Exact Mass | 545.10 |
| IUPAC Name | 4-[[4-(4-amino-3-hydroxyphenoxy)-3,5,6-trifluoro-2-pyridinyl]oxy]benzoic acid;(2-aminophenyl) hydrogen carbonate |
| SMILES | Nc1ccc(Oc2c(F)c(F)nc(Oc3ccc(C(=O)O)cc3)c2F)cc1O.Nc1ccccc1OC(=O)O |
| InChI | InChI=1S/C18H11F3N2O5.C7H7NO3/c19-13-15(27-10-5-6-11(22)12(24)7-10)14(20)17(23-16(13)21)28-9-3-1-8(2-4-9)18(25)26;8-5-3-1-2-4-6(5)11-7(9)10/h1-7,24H,22H2,(H,25,26);1-4H,8H2,(H,9,10) |
| InChIKey | RZSOSJZVKZWXFC-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 187.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.43 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|