C13H9F5N2O — CID 18461398
2-N-methyl-4-(2,3,4,5,6-pentafluorophenoxy)benzene-1,2-diamine (PubChem CID 18461398) has the molecular formula C13H9F5N2O and a molecular weight of 304.22 g/mol. Its IUPAC name is 2-N-methyl-4-(2,3,4,5,6-pentafluorophenoxy)benzene-1,2-diamine.
| Compound Name | 2-N-methyl-4-(2,3,4,5,6-pentafluorophenoxy)benzene-1,2-diamine |
|---|---|
| PubChem CID | 18461398 |
| Molecular Formula | C13H9F5N2O |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-N-methyl-4-(2,3,4,5,6-pentafluorophenoxy)benzene-1,2-diamine |
| SMILES | CNc1cc(Oc2c(F)c(F)c(F)c(F)c2F)ccc1N |
| InChI | InChI=1S/C13H9F5N2O/c1-20-7-4-5(2-3-6(7)19)21-13-11(17)9(15)8(14)10(16)12(13)18/h2-4,20H,19H2,1H3 |
| InChIKey | CYWYUSDHDQVTGL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|