C20H10Cl4O6 — CID 139971212
4-[3-(4-carboxyphenoxy)-2,4,5,6-tetrachlorophenoxy]benzoic acid (PubChem CID 139971212) has the molecular formula C20H10Cl4O6 and a molecular weight of 488.11 g/mol. Its IUPAC name is 4-[3-(4-carboxyphenoxy)-2,4,5,6-tetrachlorophenoxy]benzoic acid.
| Compound Name | 4-[3-(4-carboxyphenoxy)-2,4,5,6-tetrachlorophenoxy]benzoic acid |
|---|---|
| PubChem CID | 139971212 |
| Molecular Formula | C20H10Cl4O6 |
| Molecular Weight | 488.11 g/mol |
| Exact Mass | 485.92 |
| IUPAC Name | 4-[3-(4-carboxyphenoxy)-2,4,5,6-tetrachlorophenoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(Oc2c(Cl)c(Cl)c(Cl)c(Oc3ccc(C(=O)O)cc3)c2Cl)cc1 |
| InChI | InChI=1S/C20H10Cl4O6/c21-13-14(22)17(29-11-5-1-9(2-6-11)19(25)26)16(24)18(15(13)23)30-12-7-3-10(4-8-12)20(27)28/h1-8H,(H,25,26)(H,27,28) |
| InChIKey | RCTZHHRDHTYXIF-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.11 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|