C27H14F8O3 — CID 58690167
(4-methoxyphenyl)-[4-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenoxy]phenyl]methanone (PubChem CID 58690167) has the molecular formula C27H14F8O3 and a molecular weight of 538.39 g/mol. Its IUPAC name is (4-methoxyphenyl)-[4-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenoxy]phenyl]methanone.
| Compound Name | (4-methoxyphenyl)-[4-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenoxy]phenyl]methanone |
|---|---|
| PubChem CID | 58690167 |
| Molecular Formula | C27H14F8O3 |
| Molecular Weight | 538.39 g/mol |
| Exact Mass | 538.08 |
| IUPAC Name | (4-methoxyphenyl)-[4-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenoxy]phenyl]methanone |
| SMILES | COc1ccc(C(=O)c2ccc(Oc3c(F)c(F)c(-c4c(F)c(F)c(C)c(F)c4F)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C27H14F8O3/c1-11-18(28)20(30)16(21(31)19(11)29)17-22(32)24(34)27(25(35)23(17)33)38-15-9-5-13(6-10-15)26(36)12-3-7-14(37-2)8-4-12/h3-10H,1-2H3 |
| InChIKey | QYVLNFUBMORZDK-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.39 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|