C21H14F4O3V — CID 157190670
[4-(4-methoxyphenoxy)phenyl]-(2,3,5,6-tetrafluoro-4-methylphenyl)methanone;vanadium (PubChem CID 157190670) has the molecular formula C21H14F4O3V and a molecular weight of 441.28 g/mol. Its IUPAC name is [4-(4-methoxyphenoxy)phenyl]-(2,3,5,6-tetrafluoro-4-methylphenyl)methanone;vanadium.
| Compound Name | [4-(4-methoxyphenoxy)phenyl]-(2,3,5,6-tetrafluoro-4-methylphenyl)methanone;vanadium |
|---|---|
| PubChem CID | 157190670 |
| Molecular Formula | C21H14F4O3V |
| Molecular Weight | 441.28 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | [4-(4-methoxyphenoxy)phenyl]-(2,3,5,6-tetrafluoro-4-methylphenyl)methanone;vanadium |
| SMILES | COc1ccc(Oc2ccc(C(=O)c3c(F)c(F)c(C)c(F)c3F)cc2)cc1.[V] |
| InChI | InChI=1S/C21H14F4O3.V/c1-11-17(22)19(24)16(20(25)18(11)23)21(26)12-3-5-14(6-4-12)28-15-9-7-13(27-2)8-10-15;/h3-10H,1-2H3; |
| InChIKey | APQVRHJAHYAYCB-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.28 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|