C29H16F8O3 — CID 126634452
(3-ethyl-2,5,6-trifluoro-4-methylphenyl)-[4-[4-(2,3,4,5,6-pentafluorobenzoyl)phenoxy]phenyl]methanone (PubChem CID 126634452) has the molecular formula C29H16F8O3 and a molecular weight of 564.43 g/mol. Its IUPAC name is (3-ethyl-2,5,6-trifluoro-4-methylphenyl)-[4-[4-(2,3,4,5,6-pentafluorobenzoyl)phenoxy]phenyl]methanone.
| Compound Name | (3-ethyl-2,5,6-trifluoro-4-methylphenyl)-[4-[4-(2,3,4,5,6-pentafluorobenzoyl)phenoxy]phenyl]methanone |
|---|---|
| PubChem CID | 126634452 |
| Molecular Formula | C29H16F8O3 |
| Molecular Weight | 564.43 g/mol |
| Exact Mass | 564.10 |
| IUPAC Name | (3-ethyl-2,5,6-trifluoro-4-methylphenyl)-[4-[4-(2,3,4,5,6-pentafluorobenzoyl)phenoxy]phenyl]methanone |
| SMILES | CCc1c(C)c(F)c(F)c(C(=O)c2ccc(Oc3ccc(C(=O)c4c(F)c(F)c(F)c(F)c4F)cc3)cc2)c1F |
| InChI | InChI=1S/C29H16F8O3/c1-3-17-12(2)20(30)22(32)18(21(17)31)28(38)13-4-8-15(9-5-13)40-16-10-6-14(7-11-16)29(39)19-23(33)25(35)27(37)26(36)24(19)34/h4-11H,3H2,1-2H3 |
| InChIKey | GNPBVZJMKOBMHU-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.43 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|