C39H20F10 — CID 143619815
9-[(3E,5E)-6-(2,3,4,5,6-pentafluorophenyl)hepta-1,3,5-trien-3-yl]-10-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]anthracene (PubChem CID 143619815) has the molecular formula C39H20F10 and a molecular weight of 678.57 g/mol. Its IUPAC name is 9-[(3E,5E)-6-(2,3,4,5,6-pentafluorophenyl)hepta-1,3,5-trien-3-yl]-10-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]anthracene.
| Compound Name | 9-[(3E,5E)-6-(2,3,4,5,6-pentafluorophenyl)hepta-1,3,5-trien-3-yl]-10-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]anthracene |
|---|---|
| PubChem CID | 143619815 |
| Molecular Formula | C39H20F10 |
| Molecular Weight | 678.57 g/mol |
| Exact Mass | 678.14 |
| IUPAC Name | 9-[(3E,5E)-6-(2,3,4,5,6-pentafluorophenyl)hepta-1,3,5-trien-3-yl]-10-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]anthracene |
| SMILES | C=C/C(=C\C=C(/C)c1c(F)c(F)c(F)c(F)c1F)c1c2ccccc2c(-c2ccc(-c3c(F)c(F)c(F)c(F)c3F)cc2)c2ccccc12 |
| InChI | InChI=1S/C39H20F10/c1-3-19(13-12-18(2)26-30(40)34(44)38(48)35(45)31(26)41)27-22-8-4-6-10-24(22)28(25-11-7-5-9-23(25)27)20-14-16-21(17-15-20)29-32(42)36(46)39(49)37(47)33(29)43/h3-17H,1H2,2H3/b18-12+,19-13+ |
| InChIKey | DHLDYUQQXZLNOR-KLCVKJMQSA-N |
| XLogP | 12.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.57 |
| LogP ≤ 5 | 12.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|