C56H50 — CID 21043379
9-(2,3,4,5,6-pentamethylphenyl)-10-[4-[10-(2,3,4,5,6-pentamethylphenyl)anthracen-9-yl]phenyl]anthracene (PubChem CID 21043379) has the molecular formula C56H50 and a molecular weight of 723.02 g/mol. Its IUPAC name is 9-(2,3,4,5,6-pentamethylphenyl)-10-[4-[10-(2,3,4,5,6-pentamethylphenyl)anthracen-9-yl]phenyl]anthracene.
| Compound Name | 9-(2,3,4,5,6-pentamethylphenyl)-10-[4-[10-(2,3,4,5,6-pentamethylphenyl)anthracen-9-yl]phenyl]anthracene |
|---|---|
| PubChem CID | 21043379 |
| Molecular Formula | C56H50 |
| Molecular Weight | 723.02 g/mol |
| Exact Mass | 722.39 |
| IUPAC Name | 9-(2,3,4,5,6-pentamethylphenyl)-10-[4-[10-(2,3,4,5,6-pentamethylphenyl)anthracen-9-yl]phenyl]anthracene |
| SMILES | Cc1c(C)c(C)c(-c2c3ccccc3c(-c3ccc(-c4c5ccccc5c(-c5c(C)c(C)c(C)c(C)c5C)c5ccccc45)cc3)c3ccccc23)c(C)c1C |
| InChI | InChI=1S/C56H50/c1-31-33(3)37(7)51(38(8)34(31)4)55-47-23-15-11-19-43(47)53(44-20-12-16-24-48(44)55)41-27-29-42(30-28-41)54-45-21-13-17-25-49(45)56(50-26-18-14-22-46(50)54)52-39(9)35(5)32(2)36(6)40(52)10/h11-30H,1-10H3 |
| InChIKey | UWTJRXZTFVFZCL-UHFFFAOYSA-N |
| XLogP | 16.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.02 |
| LogP ≤ 5 | 16.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|