C78H78 — CID 21043365
2-[4-[9,10-bis(2,3,4,5,6-pentamethylphenyl)anthracen-2-yl]phenyl]-9,10-bis(2,3,4,5,6-pentamethylphenyl)anthracene (PubChem CID 21043365) has the molecular formula C78H78 and a molecular weight of 1015.48 g/mol. Its IUPAC name is 2-[4-[9,10-bis(2,3,4,5,6-pentamethylphenyl)anthracen-2-yl]phenyl]-9,10-bis(2,3,4,5,6-pentamethylphenyl)anthracene.
| Compound Name | 2-[4-[9,10-bis(2,3,4,5,6-pentamethylphenyl)anthracen-2-yl]phenyl]-9,10-bis(2,3,4,5,6-pentamethylphenyl)anthracene |
|---|---|
| PubChem CID | 21043365 |
| Molecular Formula | C78H78 |
| Molecular Weight | 1015.48 g/mol |
| Exact Mass | 1014.61 |
| IUPAC Name | 2-[4-[9,10-bis(2,3,4,5,6-pentamethylphenyl)anthracen-2-yl]phenyl]-9,10-bis(2,3,4,5,6-pentamethylphenyl)anthracene |
| SMILES | Cc1c(C)c(C)c(-c2c3ccccc3c(-c3c(C)c(C)c(C)c(C)c3C)c3cc(-c4ccc(-c5ccc6c(-c7c(C)c(C)c(C)c(C)c7C)c7ccccc7c(-c7c(C)c(C)c(C)c(C)c7C)c6c5)cc4)ccc23)c(C)c1C |
| InChI | InChI=1S/C78H78/c1-39-43(5)51(13)71(52(14)44(39)6)75-63-25-21-23-27-65(63)77(73-55(17)47(9)41(3)48(10)56(73)18)69-37-61(33-35-67(69)75)59-29-31-60(32-30-59)62-34-36-68-70(38-62)78(74-57(19)49(11)42(4)50(12)58(74)20)66-28-24-22-26-64(66)76(68)72-53(15)45(7)40(2)46(8)54(72)16/h21-38H,1-20H3 |
| InChIKey | MTWRWRZQCNZYOA-UHFFFAOYSA-N |
| XLogP | 22.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1015.48 |
| LogP ≤ 5 | 22.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|