C26H13F5 — CID 88877437
10-(2,4-difluorophenyl)-1,4,5-trifluoro-9-phenylanthracene (PubChem CID 88877437) has the molecular formula C26H13F5 and a molecular weight of 420.38 g/mol. Its IUPAC name is 10-(2,4-difluorophenyl)-1,4,5-trifluoro-9-phenylanthracene.
| Compound Name | 10-(2,4-difluorophenyl)-1,4,5-trifluoro-9-phenylanthracene |
|---|---|
| PubChem CID | 88877437 |
| Molecular Formula | C26H13F5 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 10-(2,4-difluorophenyl)-1,4,5-trifluoro-9-phenylanthracene |
| SMILES | Fc1ccc(-c2c3c(F)cccc3c(-c3ccccc3)c3c(F)ccc(F)c23)c(F)c1 |
| InChI | InChI=1S/C26H13F5/c27-15-9-10-16(21(31)13-15)24-23-17(7-4-8-18(23)28)22(14-5-2-1-3-6-14)25-19(29)11-12-20(30)26(24)25/h1-13H |
| InChIKey | XVIYRVNQHSKQKG-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|