C27H6F14 — CID 87428335
9-(2,4-difluorophenyl)-1,2,3,4,5-pentafluoro-10-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]anthracene (PubChem CID 87428335) has the molecular formula C27H6F14 and a molecular weight of 596.32 g/mol. Its IUPAC name is 9-(2,4-difluorophenyl)-1,2,3,4,5-pentafluoro-10-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]anthracene.
| Compound Name | 9-(2,4-difluorophenyl)-1,2,3,4,5-pentafluoro-10-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]anthracene |
|---|---|
| PubChem CID | 87428335 |
| Molecular Formula | C27H6F14 |
| Molecular Weight | 596.32 g/mol |
| Exact Mass | 596.02 |
| IUPAC Name | 9-(2,4-difluorophenyl)-1,2,3,4,5-pentafluoro-10-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]anthracene |
| SMILES | Fc1ccc(-c2c3cccc(F)c3c(-c3c(F)c(F)c(C(F)(F)F)c(F)c3F)c3c(F)c(F)c(F)c(F)c23)c(F)c1 |
| InChI | InChI=1S/C27H6F14/c28-7-4-5-8(11(30)6-7)12-9-2-1-3-10(29)13(9)14(16-15(12)19(31)25(37)26(38)20(16)32)17-21(33)23(35)18(27(39,40)41)24(36)22(17)34/h1-6H |
| InChIKey | OIWIYCBPPCHRLI-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.32 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|