C14H23F8NO2 — CID 174473146
acetic acid;1,1,2,2,3,10,10,10-octafluoro-N,N-dimethyldecan-1-amine (PubChem CID 174473146) has the molecular formula C14H23F8NO2 and a molecular weight of 389.33 g/mol. Its IUPAC name is acetic acid;1,1,2,2,3,10,10,10-octafluoro-N,N-dimethyldecan-1-amine.
| Compound Name | acetic acid;1,1,2,2,3,10,10,10-octafluoro-N,N-dimethyldecan-1-amine |
|---|---|
| PubChem CID | 174473146 |
| Molecular Formula | C14H23F8NO2 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | acetic acid;1,1,2,2,3,10,10,10-octafluoro-N,N-dimethyldecan-1-amine |
| SMILES | CC(=O)O.CN(C)C(F)(F)C(F)(F)C(F)CCCCCCC(F)(F)F |
| InChI | InChI=1S/C12H19F8N.C2H4O2/c1-21(2)12(19,20)11(17,18)9(13)7-5-3-4-6-8-10(14,15)16;1-2(3)4/h9H,3-8H2,1-2H3;1H3,(H,3,4) |
| InChIKey | CPHMOIVOAARAHH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|