C24H41FN2 — CID 155204879
4-[(2S)-3-butyl-2-methyl-1,2-dihydropyridin-6-yl]-N-[2-[2-(2-fluoropent-4-enyl)cyclopropyl]ethyl]butan-1-amine (PubChem CID 155204879) has the molecular formula C24H41FN2 and a molecular weight of 376.60 g/mol. Its IUPAC name is 4-[(2S)-3-butyl-2-methyl-1,2-dihydropyridin-6-yl]-N-[2-[2-(2-fluoropent-4-enyl)cyclopropyl]ethyl]butan-1-amine.
| Compound Name | 4-[(2S)-3-butyl-2-methyl-1,2-dihydropyridin-6-yl]-N-[2-[2-(2-fluoropent-4-enyl)cyclopropyl]ethyl]butan-1-amine |
|---|---|
| PubChem CID | 155204879 |
| Molecular Formula | C24H41FN2 |
| Molecular Weight | 376.60 g/mol |
| Exact Mass | 376.33 |
| IUPAC Name | 4-[(2S)-3-butyl-2-methyl-1,2-dihydropyridin-6-yl]-N-[2-[2-(2-fluoropent-4-enyl)cyclopropyl]ethyl]butan-1-amine |
| SMILES | C=CCC(F)CC1CC1CCNCCCCC1=CC=C(CCCC)[C@H](C)N1 |
| InChI | InChI=1S/C24H41FN2/c1-4-6-10-20-12-13-24(27-19(20)3)11-7-8-15-26-16-14-21-17-22(21)18-23(25)9-5-2/h5,12-13,19,21-23,26-27H,2,4,6-11,14-18H2,1,3H3/t19-,21?,22?,23?/m0/s1 |
| InChIKey | KVLICNQCBBIROQ-GHNTVSCVSA-N |
| XLogP | 6.07 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.60 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|