C25H36F3N3 — CID 129016923
(2Z,4E)-4-N-[2-[(4,4-dimethylcyclohexa-1,5-dien-1-yl)-(2-methylpropylamino)methyl]-3-methylidenecyclopenten-1-yl]-1,1,1-trifluorohexa-2,4-diene-2,4-diamine (PubChem CID 129016923) has the molecular formula C25H36F3N3 and a molecular weight of 435.58 g/mol. Its IUPAC name is (2Z,4E)-4-N-[2-[(4,4-dimethylcyclohexa-1,5-dien-1-yl)-(2-methylpropylamino)methyl]-3-methylidenecyclopenten-1-yl]-1,1,1-trifluorohexa-2,4-diene-2,4-diamine.
| Compound Name | (2Z,4E)-4-N-[2-[(4,4-dimethylcyclohexa-1,5-dien-1-yl)-(2-methylpropylamino)methyl]-3-methylidenecyclopenten-1-yl]-1,1,1-trifluorohexa-2,4-diene-2,4-diamine |
|---|---|
| PubChem CID | 129016923 |
| Molecular Formula | C25H36F3N3 |
| Molecular Weight | 435.58 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | (2Z,4E)-4-N-[2-[(4,4-dimethylcyclohexa-1,5-dien-1-yl)-(2-methylpropylamino)methyl]-3-methylidenecyclopenten-1-yl]-1,1,1-trifluorohexa-2,4-diene-2,4-diamine |
| SMILES | C=C1CCC(NC(/C=C(\N)C(F)(F)F)=C/C)=C1C(NCC(C)C)C1=CCC(C)(C)C=C1 |
| InChI | InChI=1S/C25H36F3N3/c1-7-19(14-21(29)25(26,27)28)31-20-9-8-17(4)22(20)23(30-15-16(2)3)18-10-12-24(5,6)13-11-18/h7,10-12,14,16,23,30-31H,4,8-9,13,15,29H2,1-3,5-6H3/b19-7+,21-14- |
| InChIKey | PWLJEXXMAJOGED-FSOZVHOZSA-N |
| XLogP | 6.02 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.58 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|