C14H25FN2 — CID 154352198
4-N,4-dibutyl-3-fluorocyclohexa-1,5-diene-1,4-diamine (PubChem CID 154352198) has the molecular formula C14H25FN2 and a molecular weight of 240.37 g/mol. Its IUPAC name is 4-N,4-dibutyl-3-fluorocyclohexa-1,5-diene-1,4-diamine.
| Compound Name | 4-N,4-dibutyl-3-fluorocyclohexa-1,5-diene-1,4-diamine |
|---|---|
| PubChem CID | 154352198 |
| Molecular Formula | C14H25FN2 |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | 4-N,4-dibutyl-3-fluorocyclohexa-1,5-diene-1,4-diamine |
| SMILES | CCCCNC1(CCCC)C=CC(N)=CC1F |
| InChI | InChI=1S/C14H25FN2/c1-3-5-8-14(17-10-6-4-2)9-7-12(16)11-13(14)15/h7,9,11,13,17H,3-6,8,10,16H2,1-2H3 |
| InChIKey | PFVJJXSEORBWRO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|