C31H49F4N3 — CID 118616257
(Z)-1-N'-[(4E,7S,8Z)-7-ethyl-4,10-difluoro-9-methylundeca-4,8-dienyl]-1-N'-(4-fluoro-5-methylcyclohexa-2,4-dien-1-yl)-2-N-[(Z)-6-fluoro-5-methylhept-4-en-3-yl]ethene-1,1,2-triamine (PubChem CID 118616257) has the molecular formula C31H49F4N3 and a molecular weight of 539.75 g/mol. Its IUPAC name is (Z)-1-N'-[(4E,7S,8Z)-7-ethyl-4,10-difluoro-9-methylundeca-4,8-dienyl]-1-N'-(4-fluoro-5-methylcyclohexa-2,4-dien-1-yl)-2-N-[(Z)-6-fluoro-5-methylhept-4-en-3-yl]ethene-1,1,2-triamine.
| Compound Name | (Z)-1-N'-[(4E,7S,8Z)-7-ethyl-4,10-difluoro-9-methylundeca-4,8-dienyl]-1-N'-(4-fluoro-5-methylcyclohexa-2,4-dien-1-yl)-2-N-[(Z)-6-fluoro-5-methylhept-4-en-3-yl]ethene-1,1,2-triamine |
|---|---|
| PubChem CID | 118616257 |
| Molecular Formula | C31H49F4N3 |
| Molecular Weight | 539.75 g/mol |
| Exact Mass | 539.39 |
| IUPAC Name | (Z)-1-N'-[(4E,7S,8Z)-7-ethyl-4,10-difluoro-9-methylundeca-4,8-dienyl]-1-N'-(4-fluoro-5-methylcyclohexa-2,4-dien-1-yl)-2-N-[(Z)-6-fluoro-5-methylhept-4-en-3-yl]ethene-1,1,2-triamine |
| SMILES | CCC(/C=C(/C)C(C)F)C/C=C(/F)CCCN(/C(N)=C\NC(/C=C(/C)C(C)F)CC)C1C=CC(F)=C(C)C1 |
| InChI | InChI=1S/C31H49F4N3/c1-8-26(17-21(3)24(6)32)12-13-27(34)11-10-16-38(29-14-15-30(35)23(5)19-29)31(36)20-37-28(9-2)18-22(4)25(7)33/h13-15,17-18,20,24-26,28-29,37H,8-12,16,19,36H2,1-7H3/b21-17-,22-18-,27-13+,31-20- |
| InChIKey | ICOPXMICFHFPPY-ZAXSESKFSA-N |
| XLogP | 8.64 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.75 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|