C20H27F2N3 — CID 138711347
(1E,3E,5E)-3-N-[(2E,4E)-3,4-difluorohepta-2,4,6-trienyl]-1-N-methyl-6-(1,2,3,6-tetrahydropyridin-5-yl)hepta-1,3,5-triene-1,3-diamine (PubChem CID 138711347) has the molecular formula C20H27F2N3 and a molecular weight of 347.45 g/mol. Its IUPAC name is (1E,3E,5E)-3-N-[(2E,4E)-3,4-difluorohepta-2,4,6-trienyl]-1-N-methyl-6-(1,2,3,6-tetrahydropyridin-5-yl)hepta-1,3,5-triene-1,3-diamine.
| Compound Name | (1E,3E,5E)-3-N-[(2E,4E)-3,4-difluorohepta-2,4,6-trienyl]-1-N-methyl-6-(1,2,3,6-tetrahydropyridin-5-yl)hepta-1,3,5-triene-1,3-diamine |
|---|---|
| PubChem CID | 138711347 |
| Molecular Formula | C20H27F2N3 |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | (1E,3E,5E)-3-N-[(2E,4E)-3,4-difluorohepta-2,4,6-trienyl]-1-N-methyl-6-(1,2,3,6-tetrahydropyridin-5-yl)hepta-1,3,5-triene-1,3-diamine |
| SMILES | C=C/C=C(F)\C(F)=C/CNC(/C=C/NC)=C/C=C(\C)C1=CCCNC1 |
| InChI | InChI=1S/C20H27F2N3/c1-4-6-19(21)20(22)11-14-25-18(10-13-23-3)9-8-16(2)17-7-5-12-24-15-17/h4,6-11,13,23-25H,1,5,12,14-15H2,2-3H3/b13-10+,16-8+,18-9+,19-6+,20-11+ |
| InChIKey | JUKSNSVMOKRGJG-CPJNAHASSA-N |
| XLogP | 3.95 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|