C13H20 — CID 156747017
1-buta-1,3-dien-2-ylcyclohexa-1,3-diene;ethene;methane (PubChem CID 156747017) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 1-buta-1,3-dien-2-ylcyclohexa-1,3-diene;ethene;methane.
| Compound Name | 1-buta-1,3-dien-2-ylcyclohexa-1,3-diene;ethene;methane |
|---|---|
| PubChem CID | 156747017 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 1-buta-1,3-dien-2-ylcyclohexa-1,3-diene;ethene;methane |
| SMILES | C.C=C.C=CC(=C)C1=CC=CCC1 |
| InChI | InChI=1S/C10H12.C2H4.CH4/c1-3-9(2)10-7-5-4-6-8-10;1-2;/h3-5,7H,1-2,6,8H2;1-2H2;1H4 |
| InChIKey | FCNUMWGADBZYMT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|