C13H18 — CID 142474101
1-[(3E)-hepta-1,3-dien-4-yl]cyclohexa-1,3-diene (PubChem CID 142474101) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is 1-[(3E)-hepta-1,3-dien-4-yl]cyclohexa-1,3-diene.
| Compound Name | 1-[(3E)-hepta-1,3-dien-4-yl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142474101 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 1-[(3E)-hepta-1,3-dien-4-yl]cyclohexa-1,3-diene |
| SMILES | C=C/C=C(\CCC)C1=CC=CCC1 |
| InChI | InChI=1S/C13H18/c1-3-8-12(9-4-2)13-10-6-5-7-11-13/h3,5-6,8,10H,1,4,7,9,11H2,2H3/b12-8+ |
| InChIKey | MSAQQNVWBSDWMM-XYOKQWHBSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|