C14H18 — CID 143348775
1-[(3E)-hepta-1,3-dien-4-yl]cyclohepta-1,3,5-triene (PubChem CID 143348775) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is 1-[(3E)-hepta-1,3-dien-4-yl]cyclohepta-1,3,5-triene.
| Compound Name | 1-[(3E)-hepta-1,3-dien-4-yl]cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 143348775 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 1-[(3E)-hepta-1,3-dien-4-yl]cyclohepta-1,3,5-triene |
| SMILES | C=C/C=C(\CCC)C1=CC=CC=CC1 |
| InChI | InChI=1S/C14H18/c1-3-9-13(10-4-2)14-11-7-5-6-8-12-14/h3,5-9,11H,1,4,10,12H2,2H3/b13-9+ |
| InChIKey | BXSASRKAUFRWIV-UKTHLTGXSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|