C21H23N — CID 143402106
N-cyclohepta-1,3,5-trien-1-yl-3-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylcyclohepta-1,3,5-trien-1-amine (PubChem CID 143402106) has the molecular formula C21H23N and a molecular weight of 289.42 g/mol. Its IUPAC name is N-cyclohepta-1,3,5-trien-1-yl-3-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylcyclohepta-1,3,5-trien-1-amine.
| Compound Name | N-cyclohepta-1,3,5-trien-1-yl-3-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylcyclohepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 143402106 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-cyclohepta-1,3,5-trien-1-yl-3-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylcyclohepta-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(\C=C)C1=CC=CCC(N(C)C2=CC=CC=CC2)=C1 |
| InChI | InChI=1S/C21H23N/c1-4-12-18(5-2)19-13-10-11-16-21(17-19)22(3)20-14-8-6-7-9-15-20/h4-14,17H,1-2,15-16H2,3H3/b18-12+ |
| InChIKey | OAMHDFYMANCLRW-LDADJPATSA-N |
| XLogP | 5.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|