C17H22FN — CID 142309136
N-(2-fluoroethyl)-N-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]cyclohepta-1,4,6-trien-1-amine (PubChem CID 142309136) has the molecular formula C17H22FN and a molecular weight of 259.37 g/mol. Its IUPAC name is N-(2-fluoroethyl)-N-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]cyclohepta-1,4,6-trien-1-amine.
| Compound Name | N-(2-fluoroethyl)-N-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]cyclohepta-1,4,6-trien-1-amine |
|---|---|
| PubChem CID | 142309136 |
| Molecular Formula | C17H22FN |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | N-(2-fluoroethyl)-N-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]cyclohepta-1,4,6-trien-1-amine |
| SMILES | C=C/C=C\C=C(/C)CN(CCF)C1=CCC=CC=C1 |
| InChI | InChI=1S/C17H22FN/c1-3-4-7-10-16(2)15-19(14-13-18)17-11-8-5-6-9-12-17/h3-8,10-12H,1,9,13-15H2,2H3/b7-4-,16-10+ |
| InChIKey | PZFOMUUIGYZXIJ-VKZSLHGGSA-N |
| XLogP | 4.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|