C12H16FN — CID 134375892
(3Z,5E)-5-ethynyl-N-(2-fluoroethyl)-N-methylhepta-1,3,5-trien-2-amine (PubChem CID 134375892) has the molecular formula C12H16FN and a molecular weight of 193.26 g/mol. Its IUPAC name is (3Z,5E)-5-ethynyl-N-(2-fluoroethyl)-N-methylhepta-1,3,5-trien-2-amine.
| Compound Name | (3Z,5E)-5-ethynyl-N-(2-fluoroethyl)-N-methylhepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 134375892 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.26 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | (3Z,5E)-5-ethynyl-N-(2-fluoroethyl)-N-methylhepta-1,3,5-trien-2-amine |
| SMILES | C#CC(/C=C\C(=C)N(C)CCF)=C/C |
| InChI | InChI=1S/C12H16FN/c1-5-12(6-2)8-7-11(3)14(4)10-9-13/h1,6-8H,3,9-10H2,2,4H3/b8-7-,12-6- |
| InChIKey | BSEPNFLUFTYKLM-NHCUHXEMSA-N |
| XLogP | 2.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|