C12H22FN — CID 174287104
(3Z,5E)-N-ethyl-6-fluoro-N,3-dimethylocta-3,5-dien-4-amine (PubChem CID 174287104) has the molecular formula C12H22FN and a molecular weight of 199.31 g/mol. Its IUPAC name is (3Z,5E)-N-ethyl-6-fluoro-N,3-dimethylocta-3,5-dien-4-amine.
| Compound Name | (3Z,5E)-N-ethyl-6-fluoro-N,3-dimethylocta-3,5-dien-4-amine |
|---|---|
| PubChem CID | 174287104 |
| Molecular Formula | C12H22FN |
| Molecular Weight | 199.31 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | (3Z,5E)-N-ethyl-6-fluoro-N,3-dimethylocta-3,5-dien-4-amine |
| SMILES | CC/C(C)=C(/C=C(/F)CC)N(C)CC |
| InChI | InChI=1S/C12H22FN/c1-6-10(4)12(14(5)8-3)9-11(13)7-2/h9H,6-8H2,1-5H3/b11-9+,12-10- |
| InChIKey | GNFLYUOBWODHDE-IXIPZQGVSA-N |
| XLogP | 3.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|