C9H14F2 — CID 142010132
(2E,5Z)-2,5-difluoro-6-methylocta-2,5-diene (PubChem CID 142010132) has the molecular formula C9H14F2 and a molecular weight of 160.21 g/mol. Its IUPAC name is (2E,5Z)-2,5-difluoro-6-methylocta-2,5-diene.
| Compound Name | (2E,5Z)-2,5-difluoro-6-methylocta-2,5-diene |
|---|---|
| PubChem CID | 142010132 |
| Molecular Formula | C9H14F2 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (2E,5Z)-2,5-difluoro-6-methylocta-2,5-diene |
| SMILES | CC/C(C)=C(\F)C/C=C(\C)F |
| InChI | InChI=1S/C9H14F2/c1-4-7(2)9(11)6-5-8(3)10/h5H,4,6H2,1-3H3/b8-5+,9-7- |
| InChIKey | HBTNCSNFWDVFJM-KCGQVOQMSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |